C16H21ClO — CID 174712067
6-chloro-1,5-dimethylcyclohexa-2,4-dien-1-ol;1,2-xylene (PubChem CID 174712067) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is 6-chloro-1,5-dimethylcyclohexa-2,4-dien-1-ol;1,2-xylene.
| Compound Name | 6-chloro-1,5-dimethylcyclohexa-2,4-dien-1-ol;1,2-xylene |
|---|---|
| PubChem CID | 174712067 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 6-chloro-1,5-dimethylcyclohexa-2,4-dien-1-ol;1,2-xylene |
| SMILES | CC1=CC=CC(C)(O)C1Cl.Cc1ccccc1C |
| InChI | InChI=1S/C8H11ClO.C8H10/c1-6-4-3-5-8(2,10)7(6)9;1-7-5-3-4-6-8(7)2/h3-5,7,10H,1-2H3;3-6H,1-2H3 |
| InChIKey | JANVGIFMJHVGDJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|