C18H16O3 — CID 21407139
1-(2-hydroxy-3-phenylphenyl)cyclohexa-3,5-diene-1,3-diol (PubChem CID 21407139) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-(2-hydroxy-3-phenylphenyl)cyclohexa-3,5-diene-1,3-diol.
| Compound Name | 1-(2-hydroxy-3-phenylphenyl)cyclohexa-3,5-diene-1,3-diol |
|---|---|
| PubChem CID | 21407139 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-(2-hydroxy-3-phenylphenyl)cyclohexa-3,5-diene-1,3-diol |
| SMILES | OC1=CC=CC(O)(c2cccc(-c3ccccc3)c2O)C1 |
| InChI | InChI=1S/C18H16O3/c19-14-8-5-11-18(21,12-14)16-10-4-9-15(17(16)20)13-6-2-1-3-7-13/h1-11,19-21H,12H2 |
| InChIKey | ZKNWZIXWKXSARP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |