C24H20O2 — CID 175478558
5-phenyl-4-(2-phenylphenyl)cyclohexa-2,4-diene-1,1-diol (PubChem CID 175478558) has the molecular formula C24H20O2 and a molecular weight of 340.42 g/mol. Its IUPAC name is 5-phenyl-4-(2-phenylphenyl)cyclohexa-2,4-diene-1,1-diol.
| Compound Name | 5-phenyl-4-(2-phenylphenyl)cyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 175478558 |
| Molecular Formula | C24H20O2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 5-phenyl-4-(2-phenylphenyl)cyclohexa-2,4-diene-1,1-diol |
| SMILES | OC1(O)C=CC(c2ccccc2-c2ccccc2)=C(c2ccccc2)C1 |
| InChI | InChI=1S/C24H20O2/c25-24(26)16-15-22(23(17-24)19-11-5-2-6-12-19)21-14-8-7-13-20(21)18-9-3-1-4-10-18/h1-16,25-26H,17H2 |
| InChIKey | ZEMGVAFTNBFPPH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|