C12H14N2O — CID 174844200
4,4-diamino-2-phenylcyclohexa-1,5-dien-1-ol (PubChem CID 174844200) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 4,4-diamino-2-phenylcyclohexa-1,5-dien-1-ol.
| Compound Name | 4,4-diamino-2-phenylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 174844200 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 4,4-diamino-2-phenylcyclohexa-1,5-dien-1-ol |
| SMILES | NC1(N)C=CC(O)=C(c2ccccc2)C1 |
| InChI | InChI=1S/C12H14N2O/c13-12(14)7-6-11(15)10(8-12)9-4-2-1-3-5-9/h1-7,15H,8,13-14H2 |
| InChIKey | HFWIRCFUHHRJTB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|