About 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride
2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride (PubChem CID 174448664) has the molecular formula C13H14ClNO3
and a molecular weight of 267.71 g/mol. Its IUPAC name is 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride |
| PubChem CID | 174448664 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride |
| SMILES | Cl.NC1=CC=C(c2ccccc2)CC1(O)C(=O)O |
| InChI | InChI=1S/C13H13NO3.ClH/c14-11-7-6-10(8-13(11,17)12(15)16)9-4-2-1-3-5-9;/h1-7,17H,8,14H2,(H,15,16);1H |
| InChIKey | XEAVIUYVTKXIIV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride?
The IUPAC name of 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride (CID 174448664) is 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride.
What is the SMILES notation for 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride?
The canonical SMILES for 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride is Cl.NC1=CC=C(c2ccccc2)CC1(O)C(=O)O.
What is the InChIKey of 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride?
The InChIKey is XEAVIUYVTKXIIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3.ClH/c14-11-7-6-10(8-13(11,17)12(15)16)9-4-2-1-3-5-9;/h1-7,17H,8,14H2,(H,15,16);1H.
What are the key properties of 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride?
2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride has a molecular weight of 267.71 g/mol, XLogP of 1.55, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-hydroxy-5-phenylcyclohexa-2,4-diene-1-carboxylic acid;hydrochloride is sourced from PubChem (CID 174448664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).