C14H12O6 — CID 155677478
4-(4-carboxyphenyl)-6,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 155677478) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)-6,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 4-(4-carboxyphenyl)-6,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 155677478 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 4-(4-carboxyphenyl)-6,6-dihydroxycyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | O=C(O)C1=CC=C(c2ccc(C(=O)O)cc2)CC1(O)O |
| InChI | InChI=1S/C14H12O6/c15-12(16)9-3-1-8(2-4-9)10-5-6-11(13(17)18)14(19,20)7-10/h1-6,19-20H,7H2,(H,15,16)(H,17,18) |
| InChIKey | PNUVUPCNRVWEIV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|