C20H26N2O6 — CID 67750199
4-[2-amino-5-(4-aminophenyl)-1-(3-carboxypropoxy)cyclohexa-2,4-dien-1-yl]oxybutanoic acid (PubChem CID 67750199) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-[2-amino-5-(4-aminophenyl)-1-(3-carboxypropoxy)cyclohexa-2,4-dien-1-yl]oxybutanoic acid.
| Compound Name | 4-[2-amino-5-(4-aminophenyl)-1-(3-carboxypropoxy)cyclohexa-2,4-dien-1-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 67750199 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-[2-amino-5-(4-aminophenyl)-1-(3-carboxypropoxy)cyclohexa-2,4-dien-1-yl]oxybutanoic acid |
| SMILES | NC1=CC=C(c2ccc(N)cc2)CC1(OCCCC(=O)O)OCCCC(=O)O |
| InChI | InChI=1S/C20H26N2O6/c21-16-8-5-14(6-9-16)15-7-10-17(22)20(13-15,27-11-1-3-18(23)24)28-12-2-4-19(25)26/h5-10H,1-4,11-13,21-22H2,(H,23,24)(H,25,26) |
| InChIKey | IXDRNYLLHNOMAF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|