C12H11F2N — CID 174700520
1,2-difluoro-5-phenylcyclohexa-2,4-dien-1-amine (PubChem CID 174700520) has the molecular formula C12H11F2N and a molecular weight of 207.22 g/mol. Its IUPAC name is 1,2-difluoro-5-phenylcyclohexa-2,4-dien-1-amine.
| Compound Name | 1,2-difluoro-5-phenylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 174700520 |
| Molecular Formula | C12H11F2N |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1,2-difluoro-5-phenylcyclohexa-2,4-dien-1-amine |
| SMILES | NC1(F)CC(c2ccccc2)=CC=C1F |
| InChI | InChI=1S/C12H11F2N/c13-11-7-6-10(8-12(11,14)15)9-4-2-1-3-5-9/h1-7H,8,15H2 |
| InChIKey | CMVQNKKHIALSIP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|