C13H14FNO — CID 68728208
1-fluoro-3-methoxy-5-phenylcyclohexa-2,4-dien-1-amine (PubChem CID 68728208) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is 1-fluoro-3-methoxy-5-phenylcyclohexa-2,4-dien-1-amine.
| Compound Name | 1-fluoro-3-methoxy-5-phenylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 68728208 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-fluoro-3-methoxy-5-phenylcyclohexa-2,4-dien-1-amine |
| SMILES | COC1=CC(N)(F)CC(c2ccccc2)=C1 |
| InChI | InChI=1S/C13H14FNO/c1-16-12-7-11(8-13(14,15)9-12)10-5-3-2-4-6-10/h2-7,9H,8,15H2,1H3 |
| InChIKey | VXPJKPLLTNOUOZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|