C12H10F2 — CID 21252411
5,5-difluoro-1-phenylcyclohexa-1,3-diene (PubChem CID 21252411) has the molecular formula C12H10F2 and a molecular weight of 192.21 g/mol. Its IUPAC name is 5,5-difluoro-1-phenylcyclohexa-1,3-diene.
| Compound Name | 5,5-difluoro-1-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 21252411 |
| Molecular Formula | C12H10F2 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 5,5-difluoro-1-phenylcyclohexa-1,3-diene |
| SMILES | FC1(F)C=CC=C(c2ccccc2)C1 |
| InChI | InChI=1S/C12H10F2/c13-12(14)8-4-7-11(9-12)10-5-2-1-3-6-10/h1-8H,9H2 |
| InChIKey | MANOUGHWBMEQJU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |