C26H25N — CID 174544647
9H-carbazole;5,5-dimethyl-1-phenylcyclohexa-1,3-diene (PubChem CID 174544647) has the molecular formula C26H25N and a molecular weight of 351.49 g/mol. Its IUPAC name is 9H-carbazole;5,5-dimethyl-1-phenylcyclohexa-1,3-diene.
| Compound Name | 9H-carbazole;5,5-dimethyl-1-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 174544647 |
| Molecular Formula | C26H25N |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 9H-carbazole;5,5-dimethyl-1-phenylcyclohexa-1,3-diene |
| SMILES | CC1(C)C=CC=C(c2ccccc2)C1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C14H16.C12H9N/c1-14(2)10-6-9-13(11-14)12-7-4-3-5-8-12;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h3-10H,11H2,1-2H3;1-8,13H |
| InChIKey | ZBOIGRRIRJZJHE-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |