C25H19N — CID 138714442
3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole (PubChem CID 138714442) has the molecular formula C25H19N and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole.
| Compound Name | 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole |
|---|---|
| PubChem CID | 138714442 |
| Molecular Formula | C25H19N |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole |
| SMILES | C1=CC=C(c2ccc3[nH]c4ccc(-c5ccccc5)cc4c3c2)CC=C1 |
| InChI | InChI=1S/C25H19N/c1-2-5-9-18(8-4-1)20-12-14-24-22(16-20)23-17-21(13-15-25(23)26-24)19-10-6-3-7-11-19/h1-8,10-17,26H,9H2 |
| InChIKey | DECTVBNIVXPVRT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |