About 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole
3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole (PubChem CID 138714442) has the molecular formula C25H19N
and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole.
Molecular Properties
| Compound Name | 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole |
| PubChem CID | 138714442 |
| Molecular Formula | C25H19N |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole |
| SMILES | C1=CC=C(c2ccc3[nH]c4ccc(-c5ccccc5)cc4c3c2)CC=C1 |
| InChI | InChI=1S/C25H19N/c1-2-5-9-18(8-4-1)20-12-14-24-22(16-20)23-17-21(13-15-25(23)26-24)19-10-6-3-7-11-19/h1-8,10-17,26H,9H2 |
| InChIKey | DECTVBNIVXPVRT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole?
The IUPAC name of 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole (CID 138714442) is 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole.
What is the SMILES notation for 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole?
The canonical SMILES for 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole is C1=CC=C(c2ccc3[nH]c4ccc(-c5ccccc5)cc4c3c2)CC=C1.
What is the InChIKey of 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole?
The InChIKey is DECTVBNIVXPVRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19N/c1-2-5-9-18(8-4-1)20-12-14-24-22(16-20)23-17-21(13-15-25(23)26-24)19-10-6-3-7-11-19/h1-8,10-17,26H,9H2.
What are the key properties of 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole?
3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole has a molecular weight of 333.43 g/mol, XLogP of 6.89, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohepta-1,3,5-trien-1-yl-6-phenyl-9H-carbazole is sourced from PubChem (CID 138714442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).