C17H20 — CID 175079715
5-ethenyl-1-phenyl-5-propylcyclohexa-1,3-diene (PubChem CID 175079715) has the molecular formula C17H20 and a molecular weight of 224.35 g/mol. Its IUPAC name is 5-ethenyl-1-phenyl-5-propylcyclohexa-1,3-diene.
| Compound Name | 5-ethenyl-1-phenyl-5-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175079715 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 5-ethenyl-1-phenyl-5-propylcyclohexa-1,3-diene |
| SMILES | C=CC1(CCC)C=CC=C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H20/c1-3-12-17(4-2)13-8-11-16(14-17)15-9-6-5-7-10-15/h4-11,13H,2-3,12,14H2,1H3 |
| InChIKey | LJJFYYBSBPWRJL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|