C20H17FN2O3 — CID 87529543
1-N-(4-fluorophenyl)-1-N'-hydroxy-5-phenylcyclohexa-2,4-diene-1,1-dicarboxamide (PubChem CID 87529543) has the molecular formula C20H17FN2O3 and a molecular weight of 352.37 g/mol. Its IUPAC name is 1-N-(4-fluorophenyl)-1-N'-hydroxy-5-phenylcyclohexa-2,4-diene-1,1-dicarboxamide.
| Compound Name | 1-N-(4-fluorophenyl)-1-N'-hydroxy-5-phenylcyclohexa-2,4-diene-1,1-dicarboxamide |
|---|---|
| PubChem CID | 87529543 |
| Molecular Formula | C20H17FN2O3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-N-(4-fluorophenyl)-1-N'-hydroxy-5-phenylcyclohexa-2,4-diene-1,1-dicarboxamide |
| SMILES | O=C(NO)C1(C(=O)Nc2ccc(F)cc2)C=CC=C(c2ccccc2)C1 |
| InChI | InChI=1S/C20H17FN2O3/c21-16-8-10-17(11-9-16)22-18(24)20(19(25)23-26)12-4-7-15(13-20)14-5-2-1-3-6-14/h1-12,26H,13H2,(H,22,24)(H,23,25) |
| InChIKey | DFIJQFZKDSDVCR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|