C27H21FO2 — CID 175715465
(E)-3-[5-(4-fluorophenyl)-1-(4-hydroxyphenyl)cyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one (PubChem CID 175715465) has the molecular formula C27H21FO2 and a molecular weight of 396.46 g/mol. Its IUPAC name is (E)-3-[5-(4-fluorophenyl)-1-(4-hydroxyphenyl)cyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[5-(4-fluorophenyl)-1-(4-hydroxyphenyl)cyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 175715465 |
| Molecular Formula | C27H21FO2 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (E)-3-[5-(4-fluorophenyl)-1-(4-hydroxyphenyl)cyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/C1(c2ccc(O)cc2)C=CC=C(c2ccc(F)cc2)C1)c1ccccc1 |
| InChI | InChI=1S/C27H21FO2/c28-24-12-8-20(9-13-24)22-7-4-17-27(19-22,23-10-14-25(29)15-11-23)18-16-26(30)21-5-2-1-3-6-21/h1-18,29H,19H2/b18-16+ |
| InChIKey | PSXMFOORCWBYJR-FBMGVBCBSA-N |
| XLogP | 6.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|