C27H22O2 — CID 175715523
(E)-3-[1-(4-hydroxyphenyl)-5-phenylcyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one (PubChem CID 175715523) has the molecular formula C27H22O2 and a molecular weight of 378.47 g/mol. Its IUPAC name is (E)-3-[1-(4-hydroxyphenyl)-5-phenylcyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[1-(4-hydroxyphenyl)-5-phenylcyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 175715523 |
| Molecular Formula | C27H22O2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (E)-3-[1-(4-hydroxyphenyl)-5-phenylcyclohexa-2,4-dien-1-yl]-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/C1(c2ccc(O)cc2)C=CC=C(c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C27H22O2/c28-25-15-13-24(14-16-25)27(19-17-26(29)22-10-5-2-6-11-22)18-7-12-23(20-27)21-8-3-1-4-9-21/h1-19,28H,20H2/b19-17+ |
| InChIKey | JIOHDTFRDYHLAA-HTXNQAPBSA-N |
| XLogP | 6.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|