C17H14FN3O2 — CID 47093359
1-(4-fluorophenyl)-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]urea (PubChem CID 47093359) has the molecular formula C17H14FN3O2 and a molecular weight of 311.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 47093359 |
| Molecular Formula | C17H14FN3O2 |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]urea |
| SMILES | O=C(NCc1cc(-c2ccccc2)on1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14FN3O2/c18-13-6-8-14(9-7-13)20-17(22)19-11-15-10-16(23-21-15)12-4-2-1-3-5-12/h1-10H,11H2,(H2,19,20,22) |
| InChIKey | RHUZETSABKTXQS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |