C17H12FIN2O2 — CID 16866881
N-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-iodobenzamide (PubChem CID 16866881) has the molecular formula C17H12FIN2O2 and a molecular weight of 422.20 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-iodobenzamide.
| Compound Name | N-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 16866881 |
| Molecular Formula | C17H12FIN2O2 |
| Molecular Weight | 422.20 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | N-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]-2-iodobenzamide |
| SMILES | O=C(NCc1cc(-c2ccc(F)cc2)on1)c1ccccc1I |
| InChI | InChI=1S/C17H12FIN2O2/c18-12-7-5-11(6-8-12)16-9-13(21-23-16)10-20-17(22)14-3-1-2-4-15(14)19/h1-9H,10H2,(H,20,22) |
| InChIKey | HWSOFALJTZOPPU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.20 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|