C17H12BrFN2O2 — CID 16866880
4-bromo-N-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]benzamide (PubChem CID 16866880) has the molecular formula C17H12BrFN2O2 and a molecular weight of 375.20 g/mol. Its IUPAC name is 4-bromo-N-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]benzamide.
| Compound Name | 4-bromo-N-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 16866880 |
| Molecular Formula | C17H12BrFN2O2 |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 4-bromo-N-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl]benzamide |
| SMILES | O=C(NCc1cc(-c2ccc(F)cc2)on1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H12BrFN2O2/c18-13-5-1-12(2-6-13)17(22)20-10-15-9-16(23-21-15)11-3-7-14(19)8-4-11/h1-9H,10H2,(H,20,22) |
| InChIKey | YPCZXMWMTIRKKR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |