C17H13ClN2O2 — CID 16866496
4-chloro-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzamide (PubChem CID 16866496) has the molecular formula C17H13ClN2O2 and a molecular weight of 312.76 g/mol. Its IUPAC name is 4-chloro-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzamide.
| Compound Name | 4-chloro-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 16866496 |
| Molecular Formula | C17H13ClN2O2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-chloro-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzamide |
| SMILES | O=C(NCc1cc(-c2ccccc2)on1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClN2O2/c18-14-8-6-13(7-9-14)17(21)19-11-15-10-16(22-20-15)12-4-2-1-3-5-12/h1-10H,11H2,(H,19,21) |
| InChIKey | PSTUZOTURCZQRA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |