C23H26N2O5 — CID 16866490
3,4,5-triethoxy-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzamide (PubChem CID 16866490) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 16866490 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3,4,5-triethoxy-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCc2cc(-c3ccccc3)on2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H26N2O5/c1-4-27-20-12-17(13-21(28-5-2)22(20)29-6-3)23(26)24-15-18-14-19(30-25-18)16-10-8-7-9-11-16/h7-14H,4-6,15H2,1-3H3,(H,24,26) |
| InChIKey | LQUVHSWJASHLCG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |