C21H25N3O4 — CID 8917080
3,4,5-triethoxy-N-(imidazo[1,2-a]pyridin-2-ylmethyl)benzamide (PubChem CID 8917080) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(imidazo[1,2-a]pyridin-2-ylmethyl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(imidazo[1,2-a]pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 8917080 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 3,4,5-triethoxy-N-(imidazo[1,2-a]pyridin-2-ylmethyl)benzamide |
| SMILES | CCOc1cc(C(=O)NCc2cn3ccccc3n2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H25N3O4/c1-4-26-17-11-15(12-18(27-5-2)20(17)28-6-3)21(25)22-13-16-14-24-10-8-7-9-19(24)23-16/h7-12,14H,4-6,13H2,1-3H3,(H,22,25) |
| InChIKey | YBGHPRALGROYJS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |