C23H19N7O2 — CID 43063902
2-N,6-N-bis(imidazo[1,2-a]pyridin-2-ylmethyl)pyridine-2,6-dicarboxamide (PubChem CID 43063902) has the molecular formula C23H19N7O2 and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-N,6-N-bis(imidazo[1,2-a]pyridin-2-ylmethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(imidazo[1,2-a]pyridin-2-ylmethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 43063902 |
| Molecular Formula | C23H19N7O2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-N,6-N-bis(imidazo[1,2-a]pyridin-2-ylmethyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCc1cn2ccccc2n1)c1cccc(C(=O)NCc2cn3ccccc3n2)n1 |
| InChI | InChI=1S/C23H19N7O2/c31-22(24-12-16-14-29-10-3-1-8-20(29)26-16)18-6-5-7-19(28-18)23(32)25-13-17-15-30-11-4-2-9-21(30)27-17/h1-11,14-15H,12-13H2,(H,24,31)(H,25,32) |
| InChIKey | HZULCNDDXYBEOO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |