C10H13N5 — CID 110913540
1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylguanidine (PubChem CID 110913540) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylguanidine.
| Compound Name | 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 110913540 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\N)NCc1cn2ccccc2n1 |
| InChI | InChI=1S/C10H13N5/c1-12-10(11)13-6-8-7-15-5-3-2-4-9(15)14-8/h2-5,7H,6H2,1H3,(H3,11,12,13) |
| InChIKey | MLAQQRUFHZLNOJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|