C15H18N6S — CID 119116994
1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 119116994) has the molecular formula C15H18N6S and a molecular weight of 314.42 g/mol. Its IUPAC name is 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119116994 |
| Molecular Formula | C15H18N6S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cn2ccccc2n1)NCc1nc(C)cs1 |
| InChI | InChI=1S/C15H18N6S/c1-11-10-22-14(19-11)8-18-15(16-2)17-7-12-9-21-6-4-3-5-13(21)20-12/h3-6,9-10H,7-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | ABIQYCYEFMSVAY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|