C15H19N5OS — CID 119116936
2-[[N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]-N-phenylacetamide (PubChem CID 119116936) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is 2-[[N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]-N-phenylacetamide.
| Compound Name | 2-[[N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 119116936 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[[N'-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]carbamimidoyl]amino]-N-phenylacetamide |
| SMILES | C/N=C(/NCC(=O)Nc1ccccc1)NCc1nc(C)cs1 |
| InChI | InChI=1S/C15H19N5OS/c1-11-10-22-14(19-11)9-18-15(16-2)17-8-13(21)20-12-6-4-3-5-7-12/h3-7,10H,8-9H2,1-2H3,(H,20,21)(H2,16,17,18) |
| InChIKey | KFFWPQSRQZRECF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|