C13H20IN5S2 — CID 119146190
1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 119146190) has the molecular formula C13H20IN5S2 and a molecular weight of 437.38 g/mol. Its IUPAC name is 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119146190 |
| Molecular Formula | C13H20IN5S2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)cs1)NCc1sc(C)nc1C.I |
| InChI | InChI=1S/C13H19N5S2.HI/c1-8-7-19-12(17-8)6-16-13(14-4)15-5-11-9(2)18-10(3)20-11;/h7H,5-6H2,1-4H3,(H2,14,15,16);1H |
| InChIKey | LPELADLGELCQSR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|