C14H22IN5OS — CID 119163268
1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 119163268) has the molecular formula C14H22IN5OS and a molecular weight of 435.34 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119163268 |
| Molecular Formula | C14H22IN5OS |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1sc(C)nc1C)NCc1c(C)noc1C.I |
| InChI | InChI=1S/C14H21N5OS.HI/c1-8-12(10(3)20-19-8)6-16-14(15-5)17-7-13-9(2)18-11(4)21-13;/h6-7H2,1-5H3,(H2,15,16,17);1H |
| InChIKey | HTWJVSUSBMPJDQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|