C11H21IN4O3S — CID 119151628
1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide (PubChem CID 119151628) has the molecular formula C11H21IN4O3S and a molecular weight of 416.29 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119151628 |
| Molecular Formula | C11H21IN4O3S |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)NCc1c(C)noc1C.I |
| InChI | InChI=1S/C11H20N4O3S.HI/c1-8-10(9(2)18-15-8)7-14-11(12-3)13-5-6-19(4,16)17;/h5-7H2,1-4H3,(H2,12,13,14);1H |
| InChIKey | CIVNTJSGKUTAQD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|