C12H21IN4O — CID 119149389
1-(cyclopropylmethyl)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 119149389) has the molecular formula C12H21IN4O and a molecular weight of 364.23 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(cyclopropylmethyl)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119149389 |
| Molecular Formula | C12H21IN4O |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1c(C)noc1C)NCC1CC1.I |
| InChI | InChI=1S/C12H20N4O.HI/c1-8-11(9(2)17-16-8)7-15-12(13-3)14-6-10-4-5-10;/h10H,4-7H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | ILJNYLDFNPZNCT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|