C17H18Cl2N4O — CID 111197646
2-[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-phenylacetamide (PubChem CID 111197646) has the molecular formula C17H18Cl2N4O and a molecular weight of 365.26 g/mol. Its IUPAC name is 2-[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-phenylacetamide.
| Compound Name | 2-[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 111197646 |
| Molecular Formula | C17H18Cl2N4O |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-[[N-[(2,4-dichlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-phenylacetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccccc1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N4O/c1-20-17(21-10-12-7-8-13(18)9-15(12)19)22-11-16(24)23-14-5-3-2-4-6-14/h2-9H,10-11H2,1H3,(H,23,24)(H2,20,21,22) |
| InChIKey | AGKQOPVAFFCDOG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|