C19H23ClN4O2 — CID 111680578
2-[[N-[2-(4-chlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-phenylacetamide (PubChem CID 111680578) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 2-[[N-[2-(4-chlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-phenylacetamide.
| Compound Name | 2-[[N-[2-(4-chlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 111680578 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[[N-[2-(4-chlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-phenylacetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccccc1)NCC(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-14(26-17-10-8-15(20)9-11-17)12-22-19(21-2)23-13-18(25)24-16-6-4-3-5-7-16/h3-11,14H,12-13H2,1-2H3,(H,24,25)(H2,21,22,23) |
| InChIKey | TWASMNFQEUYPSN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|