C14H18ClN3O — CID 111680392
1-[2-(4-chlorophenoxy)propyl]-2-methyl-3-prop-2-ynylguanidine (PubChem CID 111680392) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)propyl]-2-methyl-3-prop-2-ynylguanidine.
| Compound Name | 1-[2-(4-chlorophenoxy)propyl]-2-methyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 111680392 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)propyl]-2-methyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N\C)NCC(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClN3O/c1-4-9-17-14(16-3)18-10-11(2)19-13-7-5-12(15)6-8-13/h1,5-8,11H,9-10H2,2-3H3,(H2,16,17,18) |
| InChIKey | IUYLRCUJZVLMCD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|