C15H26ClIN4O3S — CID 111680511
1-[2-(4-chlorophenoxy)propyl]-3-[3-(methanesulfonamido)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111680511) has the molecular formula C15H26ClIN4O3S and a molecular weight of 504.82 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)propyl]-3-[3-(methanesulfonamido)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenoxy)propyl]-3-[3-(methanesulfonamido)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111680511 |
| Molecular Formula | C15H26ClIN4O3S |
| Molecular Weight | 504.82 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)propyl]-3-[3-(methanesulfonamido)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCNS(C)(=O)=O)NCC(C)Oc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C15H25ClN4O3S.HI/c1-12(23-14-7-5-13(16)6-8-14)11-19-15(17-2)18-9-4-10-20-24(3,21)22;/h5-8,12,20H,4,9-11H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | YUGPMKUFPHRUJT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.82 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|