C14H23FN4O3S — CID 111678050
1-[2-(4-fluorophenoxy)propyl]-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine (PubChem CID 111678050) has the molecular formula C14H23FN4O3S and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)propyl]-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-fluorophenoxy)propyl]-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111678050 |
| Molecular Formula | C14H23FN4O3S |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)propyl]-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCNS(C)(=O)=O)NCC(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C14H23FN4O3S/c1-11(22-13-6-4-12(15)5-7-13)10-18-14(16-2)17-8-9-19-23(3,20)21/h4-7,11,19H,8-10H2,1-3H3,(H2,16,17,18) |
| InChIKey | HFMBYARZVCCYGB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|