C15H19IN6S — CID 119116993
1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 119116993) has the molecular formula C15H19IN6S and a molecular weight of 442.33 g/mol. Its IUPAC name is 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119116993 |
| Molecular Formula | C15H19IN6S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 1-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cn2ccccc2n1)NCc1nc(C)cs1.I |
| InChI | InChI=1S/C15H18N6S.HI/c1-11-10-22-14(19-11)8-18-15(16-2)17-7-12-9-21-6-4-3-5-13(21)20-12;/h3-6,9-10H,7-8H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | OUNSCHHJOVPKHO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|