C21H24BrN3O4 — CID 55976377
N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3,4,5-triethoxybenzamide (PubChem CID 55976377) has the molecular formula C21H24BrN3O4 and a molecular weight of 462.34 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 55976377 |
| Molecular Formula | C21H24BrN3O4 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCc2cn3cc(Br)ccc3n2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H24BrN3O4/c1-4-27-17-9-14(10-18(28-5-2)20(17)29-6-3)21(26)23-11-16-13-25-12-15(22)7-8-19(25)24-16/h7-10,12-13H,4-6,11H2,1-3H3,(H,23,26) |
| InChIKey | INFNIYHFOFDAOF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |