C19H18N2O2 — CID 16866597
2-methyl-N-[[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl]benzamide (PubChem CID 16866597) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-methyl-N-[[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl]benzamide.
| Compound Name | 2-methyl-N-[[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 16866597 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-methyl-N-[[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl]benzamide |
| SMILES | Cc1ccc(-c2cc(CNC(=O)c3ccccc3C)no2)cc1 |
| InChI | InChI=1S/C19H18N2O2/c1-13-7-9-15(10-8-13)18-11-16(21-23-18)12-20-19(22)17-6-4-3-5-14(17)2/h3-11H,12H2,1-2H3,(H,20,22) |
| InChIKey | VHYNFKAAFIDSST-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |