C21H24N2O2 — CID 16866467
N-[(5-phenyl-1,2-oxazol-3-yl)methyl]adamantane-1-carboxamide (PubChem CID 16866467) has the molecular formula C21H24N2O2 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-[(5-phenyl-1,2-oxazol-3-yl)methyl]adamantane-1-carboxamide.
| Compound Name | N-[(5-phenyl-1,2-oxazol-3-yl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 16866467 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[(5-phenyl-1,2-oxazol-3-yl)methyl]adamantane-1-carboxamide |
| SMILES | O=C(NCc1cc(-c2ccccc2)on1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H24N2O2/c24-20(21-10-14-6-15(11-21)8-16(7-14)12-21)22-13-18-9-19(25-23-18)17-4-2-1-3-5-17/h1-5,9,14-16H,6-8,10-13H2,(H,22,24) |
| InChIKey | YKJPTAVOKWOMGH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |