C21H23ClN2O2 — CID 16866721
N-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]adamantane-1-carboxamide (PubChem CID 16866721) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 16866721 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]adamantane-1-carboxamide |
| SMILES | O=C(NCc1cc(-c2ccc(Cl)cc2)on1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H23ClN2O2/c22-17-3-1-16(2-4-17)19-8-18(24-26-19)12-23-20(25)21-9-13-5-14(10-21)7-15(6-13)11-21/h1-4,8,13-15H,5-7,9-12H2,(H,23,25) |
| InChIKey | TVWOEWDAUZOJPY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |