C27H28N2O2 — CID 16867478
N-[[5-(4-phenylphenyl)-1,2-oxazol-3-yl]methyl]adamantane-1-carboxamide (PubChem CID 16867478) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[[5-(4-phenylphenyl)-1,2-oxazol-3-yl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[5-(4-phenylphenyl)-1,2-oxazol-3-yl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 16867478 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-[[5-(4-phenylphenyl)-1,2-oxazol-3-yl]methyl]adamantane-1-carboxamide |
| SMILES | O=C(NCc1cc(-c2ccc(-c3ccccc3)cc2)on1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H28N2O2/c30-26(27-14-18-10-19(15-27)12-20(11-18)16-27)28-17-24-13-25(31-29-24)23-8-6-22(7-9-23)21-4-2-1-3-5-21/h1-9,13,18-20H,10-12,14-17H2,(H,28,30) |
| InChIKey | WZIVUZODCKFKKI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |