C16H12F6O4 — CID 87565292
4-phenyl-5,5-bis(trifluoromethyl)cyclohex-3-ene-1,1-dicarboxylic acid (PubChem CID 87565292) has the molecular formula C16H12F6O4 and a molecular weight of 382.26 g/mol. Its IUPAC name is 4-phenyl-5,5-bis(trifluoromethyl)cyclohex-3-ene-1,1-dicarboxylic acid.
| Compound Name | 4-phenyl-5,5-bis(trifluoromethyl)cyclohex-3-ene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 87565292 |
| Molecular Formula | C16H12F6O4 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 4-phenyl-5,5-bis(trifluoromethyl)cyclohex-3-ene-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CC=C(c2ccccc2)C(C(F)(F)F)(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H12F6O4/c17-15(18,19)14(16(20,21)22)8-13(11(23)24,12(25)26)7-6-10(14)9-4-2-1-3-5-9/h1-6H,7-8H2,(H,23,24)(H,25,26) |
| InChIKey | SLEUABHKYXSJNY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|