C28H46O2 — CID 126481697
2,2,6,6-tetratert-butyl-3-phenylcyclohex-3-ene-1,1-diol (PubChem CID 126481697) has the molecular formula C28H46O2 and a molecular weight of 414.67 g/mol. Its IUPAC name is 2,2,6,6-tetratert-butyl-3-phenylcyclohex-3-ene-1,1-diol.
| Compound Name | 2,2,6,6-tetratert-butyl-3-phenylcyclohex-3-ene-1,1-diol |
|---|---|
| PubChem CID | 126481697 |
| Molecular Formula | C28H46O2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | 2,2,6,6-tetratert-butyl-3-phenylcyclohex-3-ene-1,1-diol |
| SMILES | CC(C)(C)C1(C(C)(C)C)CC=C(c2ccccc2)C(C(C)(C)C)(C(C)(C)C)C1(O)O |
| InChI | InChI=1S/C28H46O2/c1-22(2,3)26(23(4,5)6)19-18-21(20-16-14-13-15-17-20)27(24(7,8)9,25(10,11)12)28(26,29)30/h13-18,29-30H,19H2,1-12H3 |
| InChIKey | BFJBKIHLYDKSDC-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|