C14H20N2O2 — CID 129319267
5,5-dimethoxy-4-phenylcyclohex-3-ene-1,1-diamine (PubChem CID 129319267) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 5,5-dimethoxy-4-phenylcyclohex-3-ene-1,1-diamine.
| Compound Name | 5,5-dimethoxy-4-phenylcyclohex-3-ene-1,1-diamine |
|---|---|
| PubChem CID | 129319267 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 5,5-dimethoxy-4-phenylcyclohex-3-ene-1,1-diamine |
| SMILES | COC1(OC)CC(N)(N)CC=C1c1ccccc1 |
| InChI | InChI=1S/C14H20N2O2/c1-17-14(18-2)10-13(15,16)9-8-12(14)11-6-4-3-5-7-11/h3-8H,9-10,15-16H2,1-2H3 |
| InChIKey | YPEFNDLGZNMYSE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|