C17H16O2 — CID 13263851
2-methoxy-2,5-diphenyl-3H-furan (PubChem CID 13263851) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-methoxy-2,5-diphenyl-3H-furan.
| Compound Name | 2-methoxy-2,5-diphenyl-3H-furan |
|---|---|
| PubChem CID | 13263851 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-methoxy-2,5-diphenyl-3H-furan |
| SMILES | COC1(c2ccccc2)CC=C(c2ccccc2)O1 |
| InChI | InChI=1S/C17H16O2/c1-18-17(15-10-6-3-7-11-15)13-12-16(19-17)14-8-4-2-5-9-14/h2-12H,13H2,1H3 |
| InChIKey | RNMPCDXTBLNIAU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |