C13H15Br2NO — CID 70183955
5,5-dibromo-1-methoxy-2-phenylcyclohex-2-en-1-amine (PubChem CID 70183955) has the molecular formula C13H15Br2NO and a molecular weight of 361.08 g/mol. Its IUPAC name is 5,5-dibromo-1-methoxy-2-phenylcyclohex-2-en-1-amine.
| Compound Name | 5,5-dibromo-1-methoxy-2-phenylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 70183955 |
| Molecular Formula | C13H15Br2NO |
| Molecular Weight | 361.08 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 5,5-dibromo-1-methoxy-2-phenylcyclohex-2-en-1-amine |
| SMILES | COC1(N)CC(Br)(Br)CC=C1c1ccccc1 |
| InChI | InChI=1S/C13H15Br2NO/c1-17-13(16)9-12(14,15)8-7-11(13)10-5-3-2-4-6-10/h2-7H,8-9,16H2,1H3 |
| InChIKey | ZNRRUFQZUMODMW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.08 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|