C12H10Cl4 — CID 53412432
4,4,6,6-tetrachloro-1-phenylcyclohexene (PubChem CID 53412432) has the molecular formula C12H10Cl4 and a molecular weight of 296.02 g/mol. Its IUPAC name is 4,4,6,6-tetrachloro-1-phenylcyclohexene.
| Compound Name | 4,4,6,6-tetrachloro-1-phenylcyclohexene |
|---|---|
| PubChem CID | 53412432 |
| Molecular Formula | C12H10Cl4 |
| Molecular Weight | 296.02 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | 4,4,6,6-tetrachloro-1-phenylcyclohexene |
| SMILES | ClC1(Cl)CC=C(c2ccccc2)C(Cl)(Cl)C1 |
| InChI | InChI=1S/C12H10Cl4/c13-11(14)7-6-10(12(15,16)8-11)9-4-2-1-3-5-9/h1-6H,7-8H2 |
| InChIKey | FCJQOWWVJFTXBN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.02 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|