C12H6Cl6 — CID 57350426
1,2,3,3,6,6-hexachloro-4-phenylcyclohexa-1,4-diene (PubChem CID 57350426) has the molecular formula C12H6Cl6 and a molecular weight of 362.90 g/mol. Its IUPAC name is 1,2,3,3,6,6-hexachloro-4-phenylcyclohexa-1,4-diene.
| Compound Name | 1,2,3,3,6,6-hexachloro-4-phenylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 57350426 |
| Molecular Formula | C12H6Cl6 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 359.86 |
| IUPAC Name | 1,2,3,3,6,6-hexachloro-4-phenylcyclohexa-1,4-diene |
| SMILES | ClC1=C(Cl)C(Cl)(Cl)C(c2ccccc2)=CC1(Cl)Cl |
| InChI | InChI=1S/C12H6Cl6/c13-9-10(14)12(17,18)8(6-11(9,15)16)7-4-2-1-3-5-7/h1-6H |
| InChIKey | CPLIBTJXAFVPBH-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|