C38H24Cl4 — CID 6312790
(7E)-1,2-dichloro-7-(2,3-dichloro-4,7-diphenylcyclohepta-2,4,6-trien-1-ylidene)-3,6-diphenylcyclohepta-1,3,5-triene (PubChem CID 6312790) has the molecular formula C38H24Cl4 and a molecular weight of 622.42 g/mol. Its IUPAC name is (7E)-1,2-dichloro-7-(2,3-dichloro-4,7-diphenylcyclohepta-2,4,6-trien-1-ylidene)-3,6-diphenylcyclohepta-1,3,5-triene.
| Compound Name | (7E)-1,2-dichloro-7-(2,3-dichloro-4,7-diphenylcyclohepta-2,4,6-trien-1-ylidene)-3,6-diphenylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 6312790 |
| Molecular Formula | C38H24Cl4 |
| Molecular Weight | 622.42 g/mol |
| Exact Mass | 620.06 |
| IUPAC Name | (7E)-1,2-dichloro-7-(2,3-dichloro-4,7-diphenylcyclohepta-2,4,6-trien-1-ylidene)-3,6-diphenylcyclohepta-1,3,5-triene |
| SMILES | ClC1=C(Cl)/C(=C2\C(c3ccccc3)=CC=C(c3ccccc3)C(Cl)=C2Cl)C(c2ccccc2)=CC=C1c1ccccc1 |
| InChI | InChI=1S/C38H24Cl4/c39-35-31(27-17-9-3-10-18-27)23-21-29(25-13-5-1-6-14-25)33(37(35)41)34-30(26-15-7-2-8-16-26)22-24-32(36(40)38(34)42)28-19-11-4-12-20-28/h1-24H/b34-33+ |
| InChIKey | AQPICIXUMJSMEF-JEIPZWNWSA-N |
| XLogP | 12.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.42 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |