C12H8Cl3F — CID 170987585
3,6,6-trichloro-5-fluoro-1-phenylcyclohexa-1,3-diene (PubChem CID 170987585) has the molecular formula C12H8Cl3F and a molecular weight of 277.55 g/mol. Its IUPAC name is 3,6,6-trichloro-5-fluoro-1-phenylcyclohexa-1,3-diene.
| Compound Name | 3,6,6-trichloro-5-fluoro-1-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 170987585 |
| Molecular Formula | C12H8Cl3F |
| Molecular Weight | 277.55 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 3,6,6-trichloro-5-fluoro-1-phenylcyclohexa-1,3-diene |
| SMILES | FC1C=C(Cl)C=C(c2ccccc2)C1(Cl)Cl |
| InChI | InChI=1S/C12H8Cl3F/c13-9-6-10(8-4-2-1-3-5-8)12(14,15)11(16)7-9/h1-7,11H |
| InChIKey | RFTLHTCHNMJAJI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|